C18H32N2O6S — CID 91168069
3-(2,5-dihydroxy-1-propylpyrrol-3-yl)sulfanyl-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]propanamide (PubChem CID 91168069) has the molecular formula C18H32N2O6S and a molecular weight of 404.53 g/mol. Its IUPAC name is 3-(2,5-dihydroxy-1-propylpyrrol-3-yl)sulfanyl-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]propanamide.
| Compound Name | 3-(2,5-dihydroxy-1-propylpyrrol-3-yl)sulfanyl-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 91168069 |
| Molecular Formula | C18H32N2O6S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | 3-(2,5-dihydroxy-1-propylpyrrol-3-yl)sulfanyl-N-[2-[2-(2-ethoxyethoxy)ethoxy]ethyl]propanamide |
| SMILES | CCCn1c(O)cc(SCCC(=O)NCCOCCOCCOCC)c1O |
| InChI | InChI=1S/C18H32N2O6S/c1-3-7-20-17(22)14-15(18(20)23)27-13-5-16(21)19-6-8-25-11-12-26-10-9-24-4-2/h14,22-23H,3-13H2,1-2H3,(H,19,21) |
| InChIKey | HLGQZYAFVKUYMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|