C12H21Cl7N2O10S2 — CID 91173913
bis(trichloromethyl) carbonate;[2-carbonochloridoyloxyethyl(methyl)amino] methanesulfinate;[2-hydroxyethyl(methyl)amino] methanesulfinate (PubChem CID 91173913) has the molecular formula C12H21Cl7N2O10S2 and a molecular weight of 665.61 g/mol. Its IUPAC name is bis(trichloromethyl) carbonate;[2-carbonochloridoyloxyethyl(methyl)amino] methanesulfinate;[2-hydroxyethyl(methyl)amino] methanesulfinate.
| Compound Name | bis(trichloromethyl) carbonate;[2-carbonochloridoyloxyethyl(methyl)amino] methanesulfinate;[2-hydroxyethyl(methyl)amino] methanesulfinate |
|---|---|
| PubChem CID | 91173913 |
| Molecular Formula | C12H21Cl7N2O10S2 |
| Molecular Weight | 665.61 g/mol |
| Exact Mass | 661.85 |
| IUPAC Name | bis(trichloromethyl) carbonate;[2-carbonochloridoyloxyethyl(methyl)amino] methanesulfinate;[2-hydroxyethyl(methyl)amino] methanesulfinate |
| SMILES | CN(CCO)OS(C)=O.CN(CCOC(=O)Cl)OS(C)=O.O=C(OC(Cl)(Cl)Cl)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C5H10ClNO4S.C4H11NO3S.C3Cl6O3/c1-7(11-12(2)9)3-4-10-5(6)8;1-5(3-4-6)8-9(2)7;4-2(5,6)11-1(10)12-3(7,8)9/h3-4H2,1-2H3;6H,3-4H2,1-2H3; |
| InChIKey | WXXSMSHEYVORER-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|