About 3,4-dimethylhexane
3,4-dimethylhexane (PubChem CID 91176006) has the molecular formula C8H17-
and a molecular weight of 113.22 g/mol. Its IUPAC name is 3,4-dimethylhexane.
Molecular Properties
| Compound Name | 3,4-dimethylhexane |
| PubChem CID | 91176006 |
| Molecular Formula | C8H17- |
| Molecular Weight | 113.22 g/mol |
| Exact Mass | 113.13 |
| IUPAC Name | 3,4-dimethylhexane |
| SMILES | CC[C-](C)C(C)CC |
| InChI | InChI=1S/C8H17/c1-5-7(3)8(4)6-2/h7H,5-6H2,1-4H3/q-1 |
| InChIKey | PVAXORLDCHGQAW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.22 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethylhexane?
The IUPAC name of 3,4-dimethylhexane (CID 91176006) is 3,4-dimethylhexane.
What is the SMILES notation for 3,4-dimethylhexane?
The canonical SMILES for 3,4-dimethylhexane is CC[C-](C)C(C)CC.
What is the InChIKey of 3,4-dimethylhexane?
The InChIKey is PVAXORLDCHGQAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17/c1-5-7(3)8(4)6-2/h7H,5-6H2,1-4H3/q-1.
What are the key properties of 3,4-dimethylhexane?
3,4-dimethylhexane has a molecular weight of 113.22 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethylhexane is sourced from PubChem (CID 91176006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).