C22H46O6Si2 — CID 91212399
[3-[3-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]-3-methylbutoxy]-3-methylbutyl] 2-methylprop-2-enoate (PubChem CID 91212399) has the molecular formula C22H46O6Si2 and a molecular weight of 462.78 g/mol. Its IUPAC name is [3-[3-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]-3-methylbutoxy]-3-methylbutyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]-3-methylbutoxy]-3-methylbutyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91212399 |
| Molecular Formula | C22H46O6Si2 |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | [3-[3-[3-(hydroxy-methyl-trimethylsilyloxysilyl)-2-methylpropoxy]-3-methylbutoxy]-3-methylbutyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(C)(C)OCCC(C)(C)OCC(C)C[Si](C)(O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H46O6Si2/c1-18(2)20(23)25-14-12-21(4,5)26-15-13-22(6,7)27-16-19(3)17-30(11,24)28-29(8,9)10/h19,24H,1,12-17H2,2-11H3 |
| InChIKey | YMUHUQBOMXFCKQ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|