C8H13N3O4 — CID 91278766
(2S,4R)-2-azido-1,4,5-trihydroxyoct-7-en-3-one (PubChem CID 91278766) has the molecular formula C8H13N3O4 and a molecular weight of 215.21 g/mol. Its IUPAC name is (2S,4R)-2-azido-1,4,5-trihydroxyoct-7-en-3-one.
| Compound Name | (2S,4R)-2-azido-1,4,5-trihydroxyoct-7-en-3-one |
|---|---|
| PubChem CID | 91278766 |
| Molecular Formula | C8H13N3O4 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | (2S,4R)-2-azido-1,4,5-trihydroxyoct-7-en-3-one |
| SMILES | C=CCC(O)[C@@H](O)C(=O)[C@H](CO)N=[N+]=[N-] |
| InChI | InChI=1S/C8H13N3O4/c1-2-3-6(13)8(15)7(14)5(4-12)10-11-9/h2,5-6,8,12-13,15H,1,3-4H2/t5-,6?,8+/m0/s1 |
| InChIKey | HIGRVOVKMSQJAS-OHEWIBQUSA-N |
| XLogP | -0.48 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|