C16H11ClF3NO3 — CID 91324791
7-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-1,5-diol (PubChem CID 91324791) has the molecular formula C16H11ClF3NO3 and a molecular weight of 357.72 g/mol. Its IUPAC name is 7-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-1,5-diol.
| Compound Name | 7-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-1,5-diol |
|---|---|
| PubChem CID | 91324791 |
| Molecular Formula | C16H11ClF3NO3 |
| Molecular Weight | 357.72 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 7-chloro-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-1,5-diol |
| SMILES | Oc1cc(Cl)c2c(O)n(Cc3ccc(OC(F)(F)F)cc3)cc2c1 |
| InChI | InChI=1S/C16H11ClF3NO3/c17-13-6-11(22)5-10-8-21(15(23)14(10)13)7-9-1-3-12(4-2-9)24-16(18,19)20/h1-6,8,22-23H,7H2 |
| InChIKey | JNBZBQLMAFGINU-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.72 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |