C22H30 — CID 91346550
3-butyldodeca-1,3,5,7-tetraen-2-ylbenzene (PubChem CID 91346550) has the molecular formula C22H30 and a molecular weight of 294.48 g/mol. Its IUPAC name is 3-butyldodeca-1,3,5,7-tetraen-2-ylbenzene.
| Compound Name | 3-butyldodeca-1,3,5,7-tetraen-2-ylbenzene |
|---|---|
| PubChem CID | 91346550 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 3-butyldodeca-1,3,5,7-tetraen-2-ylbenzene |
| SMILES | C=C(C(=CC=CC=CCCCC)CCCC)c1ccccc1 |
| InChI | InChI=1S/C22H30/c1-4-6-8-9-10-11-13-17-21(16-7-5-2)20(3)22-18-14-12-15-19-22/h9-15,17-19H,3-8,16H2,1-2H3 |
| InChIKey | KBAJVOWEEIMPBR-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|