C33H29F3N4O8 — CID 91352639
acetyloxy 2-[2-nitro-N-(2-pyridin-2-ylethyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]butaneperoxoate (PubChem CID 91352639) has the molecular formula C33H29F3N4O8 and a molecular weight of 666.61 g/mol. Its IUPAC name is acetyloxy 2-[2-nitro-N-(2-pyridin-2-ylethyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]butaneperoxoate.
| Compound Name | acetyloxy 2-[2-nitro-N-(2-pyridin-2-ylethyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]butaneperoxoate |
|---|---|
| PubChem CID | 91352639 |
| Molecular Formula | C33H29F3N4O8 |
| Molecular Weight | 666.61 g/mol |
| Exact Mass | 666.19 |
| IUPAC Name | acetyloxy 2-[2-nitro-N-(2-pyridin-2-ylethyl)-4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]anilino]butaneperoxoate |
| SMILES | CCC(C(=O)OOOC(C)=O)N(CCc1ccccn1)c1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H29F3N4O8/c1-3-28(32(43)47-48-46-21(2)41)39(19-17-24-8-6-7-18-37-24)29-16-15-25(20-30(29)40(44)45)38-31(42)27-10-5-4-9-26(27)22-11-13-23(14-12-22)33(34,35)36/h4-16,18,20,28H,3,17,19H2,1-2H3,(H,38,42) |
| InChIKey | NPEDMHIPMFFBKB-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 150.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.61 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|