C15H26N4O4 — CID 91353482
6-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide (PubChem CID 91353482) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 6-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide.
| Compound Name | 6-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide |
|---|---|
| PubChem CID | 91353482 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 6-[3-(2,5-dihydroxy-3-methylpyrrol-1-yl)propanoylamino]-2-(methylamino)hexanamide |
| SMILES | CNC(CCCCNC(=O)CCn1c(O)cc(C)c1O)C(N)=O |
| InChI | InChI=1S/C15H26N4O4/c1-10-9-13(21)19(15(10)23)8-6-12(20)18-7-4-3-5-11(17-2)14(16)22/h9,11,17,21,23H,3-8H2,1-2H3,(H2,16,22)(H,18,20) |
| InChIKey | FTKUVBWYUIIHPL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|