C20H14N2O6S2 — CID 91360159
4-(1,3-benzoxazol-2-ylsulfanyl)-5-(1,3-benzoxazol-2-ylsulfanylmethyl)-5-(hydroxymethyl)oxolane-2,3-dione (PubChem CID 91360159) has the molecular formula C20H14N2O6S2 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-(1,3-benzoxazol-2-ylsulfanyl)-5-(1,3-benzoxazol-2-ylsulfanylmethyl)-5-(hydroxymethyl)oxolane-2,3-dione.
| Compound Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-5-(1,3-benzoxazol-2-ylsulfanylmethyl)-5-(hydroxymethyl)oxolane-2,3-dione |
|---|---|
| PubChem CID | 91360159 |
| Molecular Formula | C20H14N2O6S2 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.03 |
| IUPAC Name | 4-(1,3-benzoxazol-2-ylsulfanyl)-5-(1,3-benzoxazol-2-ylsulfanylmethyl)-5-(hydroxymethyl)oxolane-2,3-dione |
| SMILES | O=C1OC(CO)(CSc2nc3ccccc3o2)C(Sc2nc3ccccc3o2)C1=O |
| InChI | InChI=1S/C20H14N2O6S2/c23-9-20(10-29-18-21-11-5-1-3-7-13(11)26-18)16(15(24)17(25)28-20)30-19-22-12-6-2-4-8-14(12)27-19/h1-8,16,23H,9-10H2 |
| InChIKey | KTIQFHUCJKHLBV-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 115.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|