C29H32F5N3O2+2 — CID 91360163
[7-ethyl-9,11-difluoro-2-hexyl-7-methyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-6-ylidene]methyl 3-methyl-1H-imidazol-3-ium-4-carboxylate (PubChem CID 91360163) has the molecular formula C29H32F5N3O2+2 and a molecular weight of 549.58 g/mol. Its IUPAC name is [7-ethyl-9,11-difluoro-2-hexyl-7-methyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-6-ylidene]methyl 3-methyl-1H-imidazol-3-ium-4-carboxylate.
| Compound Name | [7-ethyl-9,11-difluoro-2-hexyl-7-methyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-6-ylidene]methyl 3-methyl-1H-imidazol-3-ium-4-carboxylate |
|---|---|
| PubChem CID | 91360163 |
| Molecular Formula | C29H32F5N3O2+2 |
| Molecular Weight | 549.58 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | [7-ethyl-9,11-difluoro-2-hexyl-7-methyl-10-(trifluoromethyl)benzo[a]quinolizin-5-ium-6-ylidene]methyl 3-methyl-1H-imidazol-3-ium-4-carboxylate |
| SMILES | CCCCCCc1cc[n+]2c(c1)-c1c(cc(F)c(C(F)(F)F)c1F)C(C)(CC)C2=COC(=O)c1c[nH]c[n+]1C |
| InChI | InChI=1S/C29H31F5N3O2/c1-5-7-8-9-10-18-11-12-37-21(13-18)24-19(14-20(30)25(26(24)31)29(32,33)34)28(3,6-2)23(37)16-39-27(38)22-15-35-17-36(22)4/h11-17H,5-10H2,1-4H3/q+1/p+1 |
| InChIKey | YLJWHQFMHKLFRZ-UHFFFAOYSA-O |
| XLogP | 6.55 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|