C64H88N4O4 — CID 91396935
5,15-bis(3,5-dioctoxyphenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 91396935) has the molecular formula C64H88N4O4 and a molecular weight of 977.43 g/mol. Its IUPAC name is 5,15-bis(3,5-dioctoxyphenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,15-bis(3,5-dioctoxyphenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 91396935 |
| Molecular Formula | C64H88N4O4 |
| Molecular Weight | 977.43 g/mol |
| Exact Mass | 976.68 |
| IUPAC Name | 5,15-bis(3,5-dioctoxyphenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)cc(C2=c3ccc([nH]3)=Cc3ccc([nH]3)C(c3cc(OCCCCCCCC)cc(OCCCCCCCC)c3)=c3ccc([nH]3)=Cc3ccc2[nH]3)c1 |
| InChI | InChI=1S/C64H88N4O4/c1-5-9-13-17-21-25-37-69-55-41-49(42-56(47-55)70-38-26-22-18-14-10-6-2)63-59-33-29-51(65-59)45-53-31-35-61(67-53)64(62-36-32-54(68-62)46-52-30-34-60(63)66-52)50-43-57(71-39-27-23-19-15-11-7-3)48-58(44-50)72-40-28-24-20-16-12-8-4/h29-36,41-48,65-68H,5-28,37-40H2,1-4H3 |
| InChIKey | XLFMAZOVUKFYQV-UHFFFAOYSA-N |
| XLogP | 14.42 |
| TPSA | 100.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.43 |
| LogP ≤ 5 | 14.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|