C14H12N4S2 — CID 91400826
1-(1,3-benzothiazol-2-yl)-2-(2,3-dihydro-1,3-benzothiazol-2-yl)hydrazine (PubChem CID 91400826) has the molecular formula C14H12N4S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-2-(2,3-dihydro-1,3-benzothiazol-2-yl)hydrazine.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-2-(2,3-dihydro-1,3-benzothiazol-2-yl)hydrazine |
|---|---|
| PubChem CID | 91400826 |
| Molecular Formula | C14H12N4S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-2-(2,3-dihydro-1,3-benzothiazol-2-yl)hydrazine |
| SMILES | c1ccc2c(c1)NC(NNc1nc3ccccc3s1)S2 |
| InChI | InChI=1S/C14H12N4S2/c1-3-7-11-9(5-1)15-13(19-11)17-18-14-16-10-6-2-4-8-12(10)20-14/h1-8,13,15,17H,(H,16,18) |
| InChIKey | ANVPTOZSKWLCAX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|