C28H53N7O6 — CID 91449090
2-(1-aminoethylideneamino)ethyl 6-[2-[2-[[6-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]ethoxymethyl]aziridin-1-yl]hexanoate (PubChem CID 91449090) has the molecular formula C28H53N7O6 and a molecular weight of 583.78 g/mol. Its IUPAC name is 2-(1-aminoethylideneamino)ethyl 6-[2-[2-[[6-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]ethoxymethyl]aziridin-1-yl]hexanoate.
| Compound Name | 2-(1-aminoethylideneamino)ethyl 6-[2-[2-[[6-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]ethoxymethyl]aziridin-1-yl]hexanoate |
|---|---|
| PubChem CID | 91449090 |
| Molecular Formula | C28H53N7O6 |
| Molecular Weight | 583.78 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | 2-(1-aminoethylideneamino)ethyl 6-[2-[2-[[6-(1-aminoethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]ethoxymethyl]aziridin-1-yl]hexanoate |
| SMILES | C/C(N)=N\CCCCC(NC(=O)OC(C)(C)C)C(=O)NCCOCC1CN1CCCCCC(=O)OCC/N=C(\C)N |
| InChI | InChI=1S/C28H53N7O6/c1-21(29)31-13-9-8-11-24(34-27(38)41-28(3,4)5)26(37)33-14-17-39-20-23-19-35(23)16-10-6-7-12-25(36)40-18-15-32-22(2)30/h23-24H,6-20H2,1-5H3,(H2,29,31)(H2,30,32)(H,33,37)(H,34,38) |
| InChIKey | FYRAOAZGNBVUKN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 182.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.78 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|