C12H10Cl3N2O2P — CID 91455611
5,6-dihydro-1H-benzo[h]quinazolin-2-one;phosphoryl trichloride (PubChem CID 91455611) has the molecular formula C12H10Cl3N2O2P and a molecular weight of 351.56 g/mol. Its IUPAC name is 5,6-dihydro-1H-benzo[h]quinazolin-2-one;phosphoryl trichloride.
| Compound Name | 5,6-dihydro-1H-benzo[h]quinazolin-2-one;phosphoryl trichloride |
|---|---|
| PubChem CID | 91455611 |
| Molecular Formula | C12H10Cl3N2O2P |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 349.95 |
| IUPAC Name | 5,6-dihydro-1H-benzo[h]quinazolin-2-one;phosphoryl trichloride |
| SMILES | O=P(Cl)(Cl)Cl.O=c1ncc2c([nH]1)-c1ccccc1CC2 |
| InChI | InChI=1S/C12H10N2O.Cl3OP/c15-12-13-7-9-6-5-8-3-1-2-4-10(8)11(9)14-12;1-5(2,3)4/h1-4,7H,5-6H2,(H,13,14,15); |
| InChIKey | AKEIQWGRLIONKG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|