C11H8N2S — CID 66489857
1,5-dihydroindeno[1,2-d]pyrimidine-2-thione (PubChem CID 66489857) has the molecular formula C11H8N2S and a molecular weight of 200.27 g/mol. Its IUPAC name is 1,5-dihydroindeno[1,2-d]pyrimidine-2-thione.
| Compound Name | 1,5-dihydroindeno[1,2-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 66489857 |
| Molecular Formula | C11H8N2S |
| Molecular Weight | 200.27 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,5-dihydroindeno[1,2-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)-c1ccccc1C2 |
| InChI | InChI=1S/C11H8N2S/c14-11-12-6-8-5-7-3-1-2-4-9(7)10(8)13-11/h1-4,6H,5H2,(H,12,13,14) |
| InChIKey | AVCMMKGVKFYARA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|