C28H33N3O7S — CID 91470473
tert-butyl N-[3-[4-(3,3-dimethylbutyl)-4-hydroxy-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]carbamate (PubChem CID 91470473) has the molecular formula C28H33N3O7S and a molecular weight of 555.65 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(3,3-dimethylbutyl)-4-hydroxy-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(3,3-dimethylbutyl)-4-hydroxy-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]carbamate |
|---|---|
| PubChem CID | 91470473 |
| Molecular Formula | C28H33N3O7S |
| Molecular Weight | 555.65 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | tert-butyl N-[3-[4-(3,3-dimethylbutyl)-4-hydroxy-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]carbamate |
| SMILES | CC(C)(C)CCC1(O)C(=O)C(C2=NS(=O)(=O)c3cc(NC(=O)OC(C)(C)C)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H33N3O7S/c1-26(2,3)13-14-28(35)18-10-8-7-9-17(18)22(32)21(23(28)33)24-30-19-12-11-16(15-20(19)39(36,37)31-24)29-25(34)38-27(4,5)6/h7-12,15,21,35H,13-14H2,1-6H3,(H,29,34)(H,30,31) |
| InChIKey | MQRJNBZSMXRQHT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 151.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.65 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|