C30H39N5O8S2 — CID 91600306
tert-butyl N-[2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl]carbamate (PubChem CID 91600306) has the molecular formula C30H39N5O8S2 and a molecular weight of 661.80 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 91600306 |
| Molecular Formula | C30H39N5O8S2 |
| Molecular Weight | 661.80 g/mol |
| Exact Mass | 661.22 |
| IUPAC Name | tert-butyl N-[2-[[3-[4-methyl-4-(3-methylbutyl)-1,3-dioxonaphthalen-2-yl]-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-7-yl]sulfamoylamino]ethyl]carbamate |
| SMILES | CC(C)CCC1(C)C(=O)C(C2=NS(=O)(=O)c3cc(NS(=O)(=O)NCCNC(=O)OC(C)(C)C)ccc3N2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C30H39N5O8S2/c1-18(2)13-14-30(6)21-10-8-7-9-20(21)25(36)24(26(30)37)27-33-22-12-11-19(17-23(22)44(39,40)35-27)34-45(41,42)32-16-15-31-28(38)43-29(3,4)5/h7-12,17-18,24,32,34H,13-16H2,1-6H3,(H,31,38)(H,33,35) |
| InChIKey | QMFHQOHQHBOXDO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 189.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.80 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|