C20H31NO3S — CID 91473850
S-(2-acetamido-3-oxobutyl) 6-ethylidene-2,8-dimethyl-3-methylidenenon-4-enethioate (PubChem CID 91473850) has the molecular formula C20H31NO3S and a molecular weight of 365.54 g/mol. Its IUPAC name is S-(2-acetamido-3-oxobutyl) 6-ethylidene-2,8-dimethyl-3-methylidenenon-4-enethioate.
| Compound Name | S-(2-acetamido-3-oxobutyl) 6-ethylidene-2,8-dimethyl-3-methylidenenon-4-enethioate |
|---|---|
| PubChem CID | 91473850 |
| Molecular Formula | C20H31NO3S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | S-(2-acetamido-3-oxobutyl) 6-ethylidene-2,8-dimethyl-3-methylidenenon-4-enethioate |
| SMILES | C=C(C=CC(=CC)CC(C)C)C(C)C(=O)SCC(NC(C)=O)C(C)=O |
| InChI | InChI=1S/C20H31NO3S/c1-8-18(11-13(2)3)10-9-14(4)15(5)20(24)25-12-19(16(6)22)21-17(7)23/h8-10,13,15,19H,4,11-12H2,1-3,5-7H3,(H,21,23) |
| InChIKey | VZSDQNLCOPGPRP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|