C23H35N3O8 — CID 91477100
(1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-[1-(methoxymethoxy)cyclopentyl]-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione (PubChem CID 91477100) has the molecular formula C23H35N3O8 and a molecular weight of 481.55 g/mol. Its IUPAC name is (1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-[1-(methoxymethoxy)cyclopentyl]-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione.
| Compound Name | (1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-[1-(methoxymethoxy)cyclopentyl]-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione |
|---|---|
| PubChem CID | 91477100 |
| Molecular Formula | C23H35N3O8 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | (1R,2R,9S)-4-(2,2-dimethoxyethyl)-13-[2-[1-(methoxymethoxy)cyclopentyl]-2-oxoacetyl]-4,7,13-triazatricyclo[7.3.1.02,7]tridecane-5,8-dione |
| SMILES | COCOC1(C(=O)C(=O)N2[C@@H]3CCC[C@H]2C(=O)N2CC(=O)N(CC(OC)OC)C[C@H]32)CCCC1 |
| InChI | InChI=1S/C23H35N3O8/c1-31-14-34-23(9-4-5-10-23)20(28)22(30)26-15-7-6-8-16(26)21(29)25-12-18(27)24(11-17(15)25)13-19(32-2)33-3/h15-17,19H,4-14H2,1-3H3/t15-,16+,17-/m1/s1 |
| InChIKey | IXVRGMNHILJDNN-IXDOHACOSA-N |
| XLogP | -0.09 |
| TPSA | 114.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|