About N,N-diethylethanamine;1-iodopropane
N,N-diethylethanamine;1-iodopropane (PubChem CID 91479999) has the molecular formula C9H22IN
and a molecular weight of 271.19 g/mol. Its IUPAC name is N,N-diethylethanamine;1-iodopropane.
Molecular Properties
| Compound Name | N,N-diethylethanamine;1-iodopropane |
| PubChem CID | 91479999 |
| Molecular Formula | C9H22IN |
| Molecular Weight | 271.19 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N,N-diethylethanamine;1-iodopropane |
| SMILES | CCCI.CCN(CC)CC |
| InChI | InChI=1S/C6H15N.C3H7I/c1-4-7(5-2)6-3;1-2-3-4/h4-6H2,1-3H3;2-3H2,1H3 |
| InChIKey | VGTCEJPDJVFIOG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.19 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethylethanamine;1-iodopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethylethanamine;1-iodopropane?
The IUPAC name of N,N-diethylethanamine;1-iodopropane (CID 91479999) is N,N-diethylethanamine;1-iodopropane.
What is the SMILES notation for N,N-diethylethanamine;1-iodopropane?
The canonical SMILES for N,N-diethylethanamine;1-iodopropane is CCCI.CCN(CC)CC.
What is the InChIKey of N,N-diethylethanamine;1-iodopropane?
The InChIKey is VGTCEJPDJVFIOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.C3H7I/c1-4-7(5-2)6-3;1-2-3-4/h4-6H2,1-3H3;2-3H2,1H3.
What are the key properties of N,N-diethylethanamine;1-iodopropane?
N,N-diethylethanamine;1-iodopropane has a molecular weight of 271.19 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethylethanamine;1-iodopropane is sourced from PubChem (CID 91479999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).