C24H27BrO2Si — CID 91481130
2-(2-bromophenyl)-1-[tert-butyl(diphenyl)silyl]oxyethanol (PubChem CID 91481130) has the molecular formula C24H27BrO2Si and a molecular weight of 455.47 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-[tert-butyl(diphenyl)silyl]oxyethanol.
| Compound Name | 2-(2-bromophenyl)-1-[tert-butyl(diphenyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 91481130 |
| Molecular Formula | C24H27BrO2Si |
| Molecular Weight | 455.47 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-(2-bromophenyl)-1-[tert-butyl(diphenyl)silyl]oxyethanol |
| SMILES | CC(C)(C)[Si](OC(O)Cc1ccccc1Br)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27BrO2Si/c1-24(2,3)28(20-13-6-4-7-14-20,21-15-8-5-9-16-21)27-23(26)18-19-12-10-11-17-22(19)25/h4-17,23,26H,18H2,1-3H3 |
| InChIKey | WHGPTLDRFRDMOV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|