C18H21F2N3S2 — CID 9155482
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]thiourea (PubChem CID 9155482) has the molecular formula C18H21F2N3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]thiourea |
|---|---|
| PubChem CID | 9155482 |
| Molecular Formula | C18H21F2N3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]thiourea |
| SMILES | CC1(C)[C@H]2CC=C(/C=N\NC(=S)Nc3ccc(SC(F)F)cc3)[C@H]1C2 |
| InChI | InChI=1S/C18H21F2N3S2/c1-18(2)12-4-3-11(15(18)9-12)10-21-23-17(24)22-13-5-7-14(8-6-13)25-16(19)20/h3,5-8,10,12,15-16H,4,9H2,1-2H3,(H2,22,23,24)/b21-10-/t12-,15+/m0/s1 |
| InChIKey | PXUAVPICMYRWHS-MGFHSFHSSA-N |
| XLogP | 5.27 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|