C15H12F2N4O2S2 — CID 7966184
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea (PubChem CID 7966184) has the molecular formula C15H12F2N4O2S2 and a molecular weight of 382.42 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
|---|---|
| PubChem CID | 7966184 |
| Molecular Formula | C15H12F2N4O2S2 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(Z)-(2-nitrophenyl)methylideneamino]thiourea |
| SMILES | O=[N+]([O-])c1ccccc1/C=N\NC(=S)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H12F2N4O2S2/c16-14(17)25-12-7-5-11(6-8-12)19-15(24)20-18-9-10-3-1-2-4-13(10)21(22)23/h1-9,14H,(H2,19,20,24)/b18-9- |
| InChIKey | DTFASBCVRVWJSJ-NVMNQCDNSA-N |
| XLogP | 4.23 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|