C24H36O4 — CID 91585021
(3S,4R,6R)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-6-methyl-2-(6-methylheptan-2-ylidene)cyclohexan-1-one (PubChem CID 91585021) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (3S,4R,6R)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-6-methyl-2-(6-methylheptan-2-ylidene)cyclohexan-1-one.
| Compound Name | (3S,4R,6R)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-6-methyl-2-(6-methylheptan-2-ylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 91585021 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (3S,4R,6R)-3-methoxy-4-[(4-methoxyphenyl)methoxy]-6-methyl-2-(6-methylheptan-2-ylidene)cyclohexan-1-one |
| SMILES | COc1ccc(CO[C@@H]2C[C@@H](C)C(=O)C(=C(C)CCCC(C)C)[C@@H]2OC)cc1 |
| InChI | InChI=1S/C24H36O4/c1-16(2)8-7-9-17(3)22-23(25)18(4)14-21(24(22)27-6)28-15-19-10-12-20(26-5)13-11-19/h10-13,16,18,21,24H,7-9,14-15H2,1-6H3/t18-,21-,24-/m1/s1 |
| InChIKey | KHNZPAFHPMYYRT-MEKIYTOJSA-N |
| XLogP | 5.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|