C9H11BrN2O5 — CID 91594334
3-[(2-bromoacetyl)amino]-3-(2,5-dihydroxypyrrol-1-yl)propanoic acid (PubChem CID 91594334) has the molecular formula C9H11BrN2O5 and a molecular weight of 307.10 g/mol. Its IUPAC name is 3-[(2-bromoacetyl)amino]-3-(2,5-dihydroxypyrrol-1-yl)propanoic acid.
| Compound Name | 3-[(2-bromoacetyl)amino]-3-(2,5-dihydroxypyrrol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 91594334 |
| Molecular Formula | C9H11BrN2O5 |
| Molecular Weight | 307.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 3-[(2-bromoacetyl)amino]-3-(2,5-dihydroxypyrrol-1-yl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)CBr)n1c(O)ccc1O |
| InChI | InChI=1S/C9H11BrN2O5/c10-4-6(13)11-5(3-9(16)17)12-7(14)1-2-8(12)15/h1-2,5,14-15H,3-4H2,(H,11,13)(H,16,17) |
| InChIKey | CYHMJUCLOATZGB-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.10 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|