C15H18O2S — CID 91611005
8-(3-methylsulfanylphenyl)-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 91611005) has the molecular formula C15H18O2S and a molecular weight of 262.37 g/mol. Its IUPAC name is 8-(3-methylsulfanylphenyl)-1,4-dioxaspiro[4.5]dec-7-ene.
| Compound Name | 8-(3-methylsulfanylphenyl)-1,4-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 91611005 |
| Molecular Formula | C15H18O2S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 8-(3-methylsulfanylphenyl)-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CSc1cccc(C2=CCC3(CC2)OCCO3)c1 |
| InChI | InChI=1S/C15H18O2S/c1-18-14-4-2-3-13(11-14)12-5-7-15(8-6-12)16-9-10-17-15/h2-5,11H,6-10H2,1H3 |
| InChIKey | CYKSTJUTDPNLKR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |