C11H13NO6S — CID 91622296
(4-methoxyphenyl) (ethoxycarbonylamino)-oxomethanesulfinate (PubChem CID 91622296) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is (4-methoxyphenyl) (ethoxycarbonylamino)-oxomethanesulfinate.
| Compound Name | (4-methoxyphenyl) (ethoxycarbonylamino)-oxomethanesulfinate |
|---|---|
| PubChem CID | 91622296 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | (4-methoxyphenyl) (ethoxycarbonylamino)-oxomethanesulfinate |
| SMILES | CCOC(=O)NC(=O)S(=O)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C11H13NO6S/c1-3-17-10(13)12-11(14)19(15)18-9-6-4-8(16-2)5-7-9/h4-7H,3H2,1-2H3,(H,12,13,14) |
| InChIKey | RBLGOIFTFORELZ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|