C12H9F9O8 — CID 91740609
[(3R,4S,5S,6R)-6-methoxy-4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 91740609) has the molecular formula C12H9F9O8 and a molecular weight of 452.18 g/mol. Its IUPAC name is [(3R,4S,5S,6R)-6-methoxy-4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3R,4S,5S,6R)-6-methoxy-4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91740609 |
| Molecular Formula | C12H9F9O8 |
| Molecular Weight | 452.18 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | [(3R,4S,5S,6R)-6-methoxy-4,5-bis[(2,2,2-trifluoroacetyl)oxy]oxan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CO[C@@H]1OC[C@@H](OC(=O)C(F)(F)F)[C@H](OC(=O)C(F)(F)F)[C@@H]1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H9F9O8/c1-25-6-5(29-9(24)12(19,20)21)4(28-8(23)11(16,17)18)3(2-26-6)27-7(22)10(13,14)15/h3-6H,2H2,1H3/t3-,4+,5+,6-/m1/s1 |
| InChIKey | DSZMRTJLRNFUPV-DPYQTVNSSA-N |
| XLogP | 1.41 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.18 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|