C22H26Cl2N2O2Si — CID 91747138
3-[tert-butyl(dimethyl)silyl]oxy-7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one (PubChem CID 91747138) has the molecular formula C22H26Cl2N2O2Si and a molecular weight of 449.45 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 91747138 |
| Molecular Formula | C22H26Cl2N2O2Si |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-7-chloro-5-(2-chlorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| SMILES | CN1C(=O)C(O[Si](C)(C)C(C)(C)C)N=C(c2ccccc2Cl)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C22H26Cl2N2O2Si/c1-22(2,3)29(5,6)28-20-21(27)26(4)18-12-11-14(23)13-16(18)19(25-20)15-9-7-8-10-17(15)24/h7-13,20H,1-6H3 |
| InChIKey | SIFPRRIUYFNISL-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|