C24H25N3O3 — CID 91932663
(10S)-13-butyl-14-hydroxy-10-(2-methoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one (PubChem CID 91932663) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is (10S)-13-butyl-14-hydroxy-10-(2-methoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one.
| Compound Name | (10S)-13-butyl-14-hydroxy-10-(2-methoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
|---|---|
| PubChem CID | 91932663 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (10S)-13-butyl-14-hydroxy-10-(2-methoxyphenyl)-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
| SMILES | CCCCn1c(O)c2n(c1=O)[C@@H](c1ccccc1OC)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C24H25N3O3/c1-3-4-13-26-23(28)19-14-17-15-9-5-7-11-18(15)25-21(17)22(27(19)24(26)29)16-10-6-8-12-20(16)30-2/h5-12,22,25,28H,3-4,13-14H2,1-2H3/t22-/m0/s1 |
| InChIKey | YUMAARHWRHLSLB-QFIPXVFZSA-N |
| XLogP | 4.19 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|