C24H22F3N3O2 — CID 54302296
(10S)-13-butyl-14-hydroxy-10-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one (PubChem CID 54302296) has the molecular formula C24H22F3N3O2 and a molecular weight of 441.45 g/mol. Its IUPAC name is (10S)-13-butyl-14-hydroxy-10-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one.
| Compound Name | (10S)-13-butyl-14-hydroxy-10-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
|---|---|
| PubChem CID | 54302296 |
| Molecular Formula | C24H22F3N3O2 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (10S)-13-butyl-14-hydroxy-10-[4-(trifluoromethyl)phenyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-12-one |
| SMILES | CCCCn1c(O)c2n(c1=O)[C@@H](c1ccc(C(F)(F)F)cc1)c1[nH]c3ccccc3c1C2 |
| InChI | InChI=1S/C24H22F3N3O2/c1-2-3-12-29-22(31)19-13-17-16-6-4-5-7-18(16)28-20(17)21(30(19)23(29)32)14-8-10-15(11-9-14)24(25,26)27/h4-11,21,28,31H,2-3,12-13H2,1H3/t21-/m0/s1 |
| InChIKey | SFBYJEQDFVZLJI-NRFANRHFSA-N |
| XLogP | 5.20 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|