C22H18ClN3O3S — CID 91440986
methyl 3-chloro-5-[(10R)-14-hydroxy-13-methyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-10-yl]benzoate (PubChem CID 91440986) has the molecular formula C22H18ClN3O3S and a molecular weight of 439.92 g/mol. Its IUPAC name is methyl 3-chloro-5-[(10R)-14-hydroxy-13-methyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-10-yl]benzoate.
| Compound Name | methyl 3-chloro-5-[(10R)-14-hydroxy-13-methyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-10-yl]benzoate |
|---|---|
| PubChem CID | 91440986 |
| Molecular Formula | C22H18ClN3O3S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | methyl 3-chloro-5-[(10R)-14-hydroxy-13-methyl-12-sulfanylidene-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6,14-pentaen-10-yl]benzoate |
| SMILES | COC(=O)c1cc(Cl)cc([C@@H]2c3[nH]c4ccccc4c3Cc3c(O)n(C)c(=S)n32)c1 |
| InChI | InChI=1S/C22H18ClN3O3S/c1-25-20(27)17-10-15-14-5-3-4-6-16(14)24-18(15)19(26(17)22(25)30)11-7-12(21(28)29-2)9-13(23)8-11/h3-9,19,24,27H,10H2,1-2H3/t19-/m1/s1 |
| InChIKey | DSSSNMNYSNVRDI-LJQANCHMSA-N |
| XLogP | 4.72 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|