C10H18N4O4S2 — CID 92526766
[(4R,5R)-5-[(4S,5S)-5-(carbamimidoylsulfanylmethyl)-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methyl carbamimidothioate (PubChem CID 92526766) has the molecular formula C10H18N4O4S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is [(4R,5R)-5-[(4S,5S)-5-(carbamimidoylsulfanylmethyl)-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methyl carbamimidothioate.
| Compound Name | [(4R,5R)-5-[(4S,5S)-5-(carbamimidoylsulfanylmethyl)-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 92526766 |
| Molecular Formula | C10H18N4O4S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | [(4R,5R)-5-[(4S,5S)-5-(carbamimidoylsulfanylmethyl)-1,3-dioxolan-4-yl]-1,3-dioxolan-4-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC[C@@H]1OCO[C@@H]1[C@@H]1OCO[C@@H]1CS/C(N)=N/[H] |
| InChI | InChI=1S/C10H18N4O4S2/c11-9(12)19-1-5-7(17-3-15-5)8-6(16-4-18-8)2-20-10(13)14/h5-8H,1-4H2,(H3,11,12)(H3,13,14)/t5-,6+,7-,8+ |
| InChIKey | ZXFNIIRWWJEORO-KVFPUHGPSA-N |
| XLogP | -0.28 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|