C6H12N4S2 — CID 99865416
[(5S)-2-imino-3-methyl-1,3-thiazolidin-5-yl]methyl carbamimidothioate (PubChem CID 99865416) has the molecular formula C6H12N4S2 and a molecular weight of 204.32 g/mol. Its IUPAC name is [(5S)-2-imino-3-methyl-1,3-thiazolidin-5-yl]methyl carbamimidothioate.
| Compound Name | [(5S)-2-imino-3-methyl-1,3-thiazolidin-5-yl]methyl carbamimidothioate |
|---|---|
| PubChem CID | 99865416 |
| Molecular Formula | C6H12N4S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | [(5S)-2-imino-3-methyl-1,3-thiazolidin-5-yl]methyl carbamimidothioate |
| SMILES | [H]/N=C1\S[C@H](CS/C(N)=N/[H])CN1C |
| InChI | InChI=1S/C6H12N4S2/c1-10-2-4(12-6(10)9)3-11-5(7)8/h4,9H,2-3H2,1H3,(H3,7,8)/b9-6-/t4-/m0/s1 |
| InChIKey | SVJZFTQIMMLTJH-WXTCEUJSSA-N |
| XLogP | 0.60 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|