C14H18N2O2S — CID 92527820
(6aS,10aS)-6,6,9-trimethyl-3-sulfanylidene-6a,7,8,10a-tetrahydro-4H-isochromeno[3,4-d]pyrimidin-1-one (PubChem CID 92527820) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (6aS,10aS)-6,6,9-trimethyl-3-sulfanylidene-6a,7,8,10a-tetrahydro-4H-isochromeno[3,4-d]pyrimidin-1-one.
| Compound Name | (6aS,10aS)-6,6,9-trimethyl-3-sulfanylidene-6a,7,8,10a-tetrahydro-4H-isochromeno[3,4-d]pyrimidin-1-one |
|---|---|
| PubChem CID | 92527820 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (6aS,10aS)-6,6,9-trimethyl-3-sulfanylidene-6a,7,8,10a-tetrahydro-4H-isochromeno[3,4-d]pyrimidin-1-one |
| SMILES | CC1=C[C@@H]2c3c([nH]c(=S)[nH]c3=O)OC(C)(C)[C@H]2CC1 |
| InChI | InChI=1S/C14H18N2O2S/c1-7-4-5-9-8(6-7)10-11(17)15-13(19)16-12(10)18-14(9,2)3/h6,8-9H,4-5H2,1-3H3,(H2,15,16,17,19)/t8-,9-/m0/s1 |
| InChIKey | JUUVKZVLXZUEOQ-IUCAKERBSA-N |
| XLogP | 3.04 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|