C22H37NO3 — CID 92950588
2-[2-(diethylamino)ethoxy]ethyl (2R)-2-[4-(2-methylpropyl)phenyl]butanoate (PubChem CID 92950588) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]ethyl (2R)-2-[4-(2-methylpropyl)phenyl]butanoate.
| Compound Name | 2-[2-(diethylamino)ethoxy]ethyl (2R)-2-[4-(2-methylpropyl)phenyl]butanoate |
|---|---|
| PubChem CID | 92950588 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]ethyl (2R)-2-[4-(2-methylpropyl)phenyl]butanoate |
| SMILES | CC[C@@H](C(=O)OCCOCCN(CC)CC)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C22H37NO3/c1-6-21(20-11-9-19(10-12-20)17-18(4)5)22(24)26-16-15-25-14-13-23(7-2)8-3/h9-12,18,21H,6-8,13-17H2,1-5H3/t21-/m1/s1 |
| InChIKey | IWCUIKPFNBGDGZ-OAQYLSRUSA-N |
| XLogP | 4.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|