C15H14O6 — CID 92961923
(2R,4S,5S,7S,9S,13S,14S)-7-methyl-12-methylidene-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione (PubChem CID 92961923) has the molecular formula C15H14O6 and a molecular weight of 290.27 g/mol. Its IUPAC name is (2R,4S,5S,7S,9S,13S,14S)-7-methyl-12-methylidene-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione.
| Compound Name | (2R,4S,5S,7S,9S,13S,14S)-7-methyl-12-methylidene-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione |
|---|---|
| PubChem CID | 92961923 |
| Molecular Formula | C15H14O6 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (2R,4S,5S,7S,9S,13S,14S)-7-methyl-12-methylidene-3,6,10,15-tetraoxapentacyclo[12.2.1.02,4.05,7.09,13]heptadec-1(17)-ene-11,16-dione |
| SMILES | C=C1C(=O)O[C@H]2C[C@]3(C)O[C@H]3[C@H]3O[C@@H]3C3=C[C@H](OC3=O)[C@@H]12 |
| InChI | InChI=1S/C15H14O6/c1-5-9-7-3-6(14(17)18-7)10-11(20-10)12-15(2,21-12)4-8(9)19-13(5)16/h3,7-12H,1,4H2,2H3/t7-,8-,9+,10+,11-,12-,15-/m0/s1 |
| InChIKey | JRZGAAFGODYEEA-HOTAPGTDSA-N |
| XLogP | 0.26 |
| TPSA | 77.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|