C18H34N4O12S — CID 92973905
3-[3-oxo-3-[(2Z)-2-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]hydrazinyl]propyl]sulfanyl-N-[(Z)-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]amino]propanamide (PubChem CID 92973905) has the molecular formula C18H34N4O12S and a molecular weight of 530.55 g/mol. Its IUPAC name is 3-[3-oxo-3-[(2Z)-2-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]hydrazinyl]propyl]sulfanyl-N-[(Z)-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]amino]propanamide.
| Compound Name | 3-[3-oxo-3-[(2Z)-2-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]hydrazinyl]propyl]sulfanyl-N-[(Z)-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]amino]propanamide |
|---|---|
| PubChem CID | 92973905 |
| Molecular Formula | C18H34N4O12S |
| Molecular Weight | 530.55 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | 3-[3-oxo-3-[(2Z)-2-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]hydrazinyl]propyl]sulfanyl-N-[(Z)-[(3S,4S,5R)-1,3,4,5,6-pentahydroxyhexan-2-ylidene]amino]propanamide |
| SMILES | O=C(CCSCCC(=O)N/N=C(/CO)[C@H](O)[C@H](O)[C@H](O)CO)N/N=C(/CO)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C18H34N4O12S/c23-5-9(15(31)17(33)11(27)7-25)19-21-13(29)1-3-35-4-2-14(30)22-20-10(6-24)16(32)18(34)12(28)8-26/h11-12,15-18,23-28,31-34H,1-8H2,(H,21,29)(H,22,30)/b19-9-,20-10-/t11-,12-,15+,16+,17-,18-/m1/s1 |
| InChIKey | IEBKOKPLJYNLPO-MPEARWPPSA-N |
| XLogP | -6.42 |
| TPSA | 285.22 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.55 |
| LogP ≤ 5 | -6.42 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|