C22H23N3O3 — CID 93286389
ethyl (9R,10R)-10-carbonazidoyltricyclo[10.2.2.24,7]octadeca-1(15),4,6,12(16),13,17-hexaene-9-carboxylate (PubChem CID 93286389) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is ethyl (9R,10R)-10-carbonazidoyltricyclo[10.2.2.24,7]octadeca-1(15),4,6,12(16),13,17-hexaene-9-carboxylate.
| Compound Name | ethyl (9R,10R)-10-carbonazidoyltricyclo[10.2.2.24,7]octadeca-1(15),4,6,12(16),13,17-hexaene-9-carboxylate |
|---|---|
| PubChem CID | 93286389 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | ethyl (9R,10R)-10-carbonazidoyltricyclo[10.2.2.24,7]octadeca-1(15),4,6,12(16),13,17-hexaene-9-carboxylate |
| SMILES | CCOC(=O)[C@@H]1Cc2ccc(cc2)CCc2ccc(cc2)C[C@H]1C(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C22H23N3O3/c1-2-28-22(27)20-14-18-11-7-16(8-12-18)4-3-15-5-9-17(10-6-15)13-19(20)21(26)24-25-23/h5-12,19-20H,2-4,13-14H2,1H3/t19-,20-/m1/s1 |
| InChIKey | NJHRYDHBPWRFMK-WOJBJXKFSA-N |
| XLogP | 4.20 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|