C26H32N2O7 — CID 93488666
[(2R,3R,4R,5R,6S)-2-acetyloxy-6-[(Z)-(dimethylhydrazinylidene)methyl]-4,5-bis(phenylmethoxy)oxan-3-yl] acetate (PubChem CID 93488666) has the molecular formula C26H32N2O7 and a molecular weight of 484.55 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-2-acetyloxy-6-[(Z)-(dimethylhydrazinylidene)methyl]-4,5-bis(phenylmethoxy)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-2-acetyloxy-6-[(Z)-(dimethylhydrazinylidene)methyl]-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 93488666 |
| Molecular Formula | C26H32N2O7 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-2-acetyloxy-6-[(Z)-(dimethylhydrazinylidene)methyl]-4,5-bis(phenylmethoxy)oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1O[C@@H](/C=N\N(C)C)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C26H32N2O7/c1-18(29)33-25-24(32-17-21-13-9-6-10-14-21)23(31-16-20-11-7-5-8-12-20)22(15-27-28(3)4)35-26(25)34-19(2)30/h5-15,22-26H,16-17H2,1-4H3/b27-15-/t22-,23+,24+,25+,26-/m0/s1 |
| InChIKey | IKFPDKZTSBDVRM-ZJGGTMKMSA-N |
| XLogP | 2.92 |
| TPSA | 95.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|