C4H8O2S2 — CID 93495775
(3R,4R)-dithiane-3,4-diol (PubChem CID 93495775) has the molecular formula C4H8O2S2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (3R,4R)-dithiane-3,4-diol.
| Compound Name | (3R,4R)-dithiane-3,4-diol |
|---|---|
| PubChem CID | 93495775 |
| Molecular Formula | C4H8O2S2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | (3R,4R)-dithiane-3,4-diol |
| SMILES | O[C@@H]1CCSS[C@H]1O |
| InChI | InChI=1S/C4H8O2S2/c5-3-1-2-7-8-4(3)6/h3-6H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | JSMLXTZCMDYUQJ-QWWZWVQMSA-N |
| XLogP | 0.45 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|