C15H14F2N2S — CID 9420212
(4aR,8aR)-1-(3,4-difluorophenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole (PubChem CID 9420212) has the molecular formula C15H14F2N2S and a molecular weight of 292.35 g/mol. Its IUPAC name is (4aR,8aR)-1-(3,4-difluorophenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole.
| Compound Name | (4aR,8aR)-1-(3,4-difluorophenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
|---|---|
| PubChem CID | 9420212 |
| Molecular Formula | C15H14F2N2S |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | (4aR,8aR)-1-(3,4-difluorophenyl)-4a,5,6,7,8,8a-hexahydro-[1,3]thiazolo[3,2-a]benzimidazole |
| SMILES | Fc1ccc(C2=CSC3=N[C@@H]4CCCC[C@H]4N23)cc1F |
| InChI | InChI=1S/C15H14F2N2S/c16-10-6-5-9(7-11(10)17)14-8-20-15-18-12-3-1-2-4-13(12)19(14)15/h5-8,12-13H,1-4H2/t12-,13-/m1/s1 |
| InChIKey | QABMEMKTCBXADI-CHWSQXEVSA-N |
| XLogP | 3.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |