C16H15Cl2N3O3S — CID 9467110
N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide (PubChem CID 9467110) has the molecular formula C16H15Cl2N3O3S and a molecular weight of 400.29 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
|---|---|
| PubChem CID | 9467110 |
| Molecular Formula | C16H15Cl2N3O3S |
| Molecular Weight | 400.29 g/mol |
| Exact Mass | 399.02 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2-dioxo-3,4-dihydropyrido[2,1-c][1,2,4]thiadiazine-9-carboxamide |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)C1=CC=CN2CCS(=O)(=O)N=C12 |
| InChI | InChI=1S/C16H15Cl2N3O3S/c17-12-4-3-11(14(18)10-12)5-6-19-16(22)13-2-1-7-21-8-9-25(23,24)20-15(13)21/h1-4,7,10H,5-6,8-9H2,(H,19,22) |
| InChIKey | YOKWAMVZALNLOD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |