C19H20N3O3S+ — CID 9473621
[2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-(pyrrolidin-1-ium-1-ylmethyl)benzoate (PubChem CID 9473621) has the molecular formula C19H20N3O3S+ and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-(pyrrolidin-1-ium-1-ylmethyl)benzoate.
| Compound Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-(pyrrolidin-1-ium-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 9473621 |
| Molecular Formula | C19H20N3O3S+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [2-[(3-cyanothiophen-2-yl)amino]-2-oxoethyl] 4-(pyrrolidin-1-ium-1-ylmethyl)benzoate |
| SMILES | N#Cc1ccsc1NC(=O)COC(=O)c1ccc(C[NH+]2CCCC2)cc1 |
| InChI | InChI=1S/C19H19N3O3S/c20-11-16-7-10-26-18(16)21-17(23)13-25-19(24)15-5-3-14(4-6-15)12-22-8-1-2-9-22/h3-7,10H,1-2,8-9,12-13H2,(H,21,23)/p+1 |
| InChIKey | ZPJJGDAWILIWDR-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |