C19H28N4O4S — CID 9474559
[2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 9474559) has the molecular formula C19H28N4O4S and a molecular weight of 408.52 g/mol. Its IUPAC name is [2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | [2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9474559 |
| Molecular Formula | C19H28N4O4S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | [2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)OCC(=O)Nc1ccc(N2CCCC2)c(C)c1 |
| InChI | InChI=1S/C19H28N4O4S/c1-13-11-14(5-6-16(13)23-8-3-4-9-23)21-17(24)12-27-18(25)15(7-10-28-2)22-19(20)26/h5-6,11,15H,3-4,7-10,12H2,1-2H3,(H,21,24)(H3,20,22,26)/t15-/m0/s1 |
| InChIKey | FGLPAOZJTIMYHV-HNNXBMFYSA-N |
| XLogP | 1.87 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|