C4H4O5S — CID 94865792
(3R,5R)-3,5-dihydroxy-1,4-oxathiane-2,6-dione (PubChem CID 94865792) has the molecular formula C4H4O5S and a molecular weight of 164.14 g/mol. Its IUPAC name is (3R,5R)-3,5-dihydroxy-1,4-oxathiane-2,6-dione.
| Compound Name | (3R,5R)-3,5-dihydroxy-1,4-oxathiane-2,6-dione |
|---|---|
| PubChem CID | 94865792 |
| Molecular Formula | C4H4O5S |
| Molecular Weight | 164.14 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | (3R,5R)-3,5-dihydroxy-1,4-oxathiane-2,6-dione |
| SMILES | O=C1OC(=O)[C@H](O)S[C@H]1O |
| InChI | InChI=1S/C4H4O5S/c5-1-3(7)10-4(8)2(6)9-1/h3-4,7-8H/t3-,4-/m1/s1 |
| InChIKey | MVYFGMKFMLZGGH-QWWZWVQMSA-N |
| XLogP | -1.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.14 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|