C14H18FN5O4 — CID 95632425
(2R)-1-[4-(4-fluoro-2-nitroanilino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol (PubChem CID 95632425) has the molecular formula C14H18FN5O4 and a molecular weight of 339.33 g/mol. Its IUPAC name is (2R)-1-[4-(4-fluoro-2-nitroanilino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol.
| Compound Name | (2R)-1-[4-(4-fluoro-2-nitroanilino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 95632425 |
| Molecular Formula | C14H18FN5O4 |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (2R)-1-[4-(4-fluoro-2-nitroanilino)pyrazol-1-yl]-3-[methoxy(methyl)amino]propan-2-ol |
| SMILES | CON(C)C[C@H](O)Cn1cc(Nc2ccc(F)cc2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C14H18FN5O4/c1-18(24-2)8-12(21)9-19-7-11(6-16-19)17-13-4-3-10(15)5-14(13)20(22)23/h3-7,12,17,21H,8-9H2,1-2H3/t12-/m0/s1 |
| InChIKey | JSWIRGRRMDEIFD-LBPRGKRZSA-N |
| XLogP | 1.53 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|