2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid

C12H10N2O3 — CID 96600802

IUPAC2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid
SMILESCc1nc2ccc3[nH]c(C)c(C(=O)O)c3c2o1
InChIInChI=1S/C12H10N2O3/c1-5-9(12(15)16)10-7(13-5)3-4-8-11(10)17-6(2)14-8/h3-4,13H,1-2H3,(H,15,16)
InChIKeyUEDAIJKAJYWPRI-UHFFFAOYSA-N
MW230.22 g/mol
LogP2.62
Rot. Bonds1

About 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid

2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid (PubChem CID 96600802) has the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. Its IUPAC name is 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid.

Molecular Properties

Compound Name2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid
PubChem CID96600802
Molecular FormulaC12H10N2O3
Molecular Weight230.22 g/mol
Exact Mass230.07
IUPAC Name2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid
SMILESCc1nc2ccc3[nH]c(C)c(C(=O)O)c3c2o1
InChIInChI=1S/C12H10N2O3/c1-5-9(12(15)16)10-7(13-5)3-4-8-11(10)17-6(2)14-8/h3-4,13H,1-2H3,(H,15,16)
InChIKeyUEDAIJKAJYWPRI-UHFFFAOYSA-N
XLogP2.62
TPSA79.12 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.22
LogP ≤ 52.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid?
The IUPAC name of 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid (CID 96600802) is 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid.
What is the SMILES notation for 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid?
The canonical SMILES for 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid is Cc1nc2ccc3[nH]c(C)c(C(=O)O)c3c2o1.
What is the InChIKey of 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid?
The InChIKey is UEDAIJKAJYWPRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O3/c1-5-9(12(15)16)10-7(13-5)3-4-8-11(10)17-6(2)14-8/h3-4,13H,1-2H3,(H,15,16).
What are the key properties of 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid?
2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid has a molecular weight of 230.22 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethyl-6H-pyrrolo[2,3-g][1,3]benzoxazole-8-carboxylic acid is sourced from PubChem (CID 96600802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).