C25H25ClN2O2 — CID 97021973
[(1S,7R)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 4-chlorobenzoate (PubChem CID 97021973) has the molecular formula C25H25ClN2O2 and a molecular weight of 420.94 g/mol. Its IUPAC name is [(1S,7R)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 4-chlorobenzoate.
| Compound Name | [(1S,7R)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 4-chlorobenzoate |
|---|---|
| PubChem CID | 97021973 |
| Molecular Formula | C25H25ClN2O2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | [(1S,7R)-1,10,10-trimethyl-3-phenyl-3,4-diazatricyclo[5.2.1.02,6]deca-2(6),4-dien-5-yl]methyl 4-chlorobenzoate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)c1c2c(COC(=O)c2ccc(Cl)cc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C25H25ClN2O2/c1-24(2)19-13-14-25(24,3)22-21(19)20(27-28(22)18-7-5-4-6-8-18)15-30-23(29)16-9-11-17(26)12-10-16/h4-12,19H,13-15H2,1-3H3/t19-,25+/m0/s1 |
| InChIKey | UMMQCTPMFSDMMM-UQBPGWFLSA-N |
| XLogP | 6.06 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |